C14H23ClN2O3S — CID 82879498
5-chloro-N-(3-methoxypropyl)-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide (PubChem CID 82879498) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is 5-chloro-N-(3-methoxypropyl)-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide.
| Compound Name | 5-chloro-N-(3-methoxypropyl)-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 82879498 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 5-chloro-N-(3-methoxypropyl)-N,2-dimethyl-3-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1cc(Cl)cc(S(=O)(=O)N(C)CCCOC)c1C |
| InChI | InChI=1S/C14H23ClN2O3S/c1-11-12(10-16-2)8-13(15)9-14(11)21(18,19)17(3)6-5-7-20-4/h8-9,16H,5-7,10H2,1-4H3 |
| InChIKey | TWEIWWVNJFXSFT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|