C9H4F2N2O — CID 82885512
2-(2,5-difluorophenyl)-2-isocyanatoacetonitrile (PubChem CID 82885512) has the molecular formula C9H4F2N2O and a molecular weight of 194.14 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-2-isocyanatoacetonitrile.
| Compound Name | 2-(2,5-difluorophenyl)-2-isocyanatoacetonitrile |
|---|---|
| PubChem CID | 82885512 |
| Molecular Formula | C9H4F2N2O |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2-(2,5-difluorophenyl)-2-isocyanatoacetonitrile |
| SMILES | N#CC(N=C=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C9H4F2N2O/c10-6-1-2-8(11)7(3-6)9(4-12)13-5-14/h1-3,9H |
| InChIKey | PGMOVJQIDDGAQO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|