C8H6F2N2 — CID 51887355
(2S)-2-amino-2-(2,5-difluorophenyl)acetonitrile (PubChem CID 51887355) has the molecular formula C8H6F2N2 and a molecular weight of 168.15 g/mol. Its IUPAC name is (2S)-2-amino-2-(2,5-difluorophenyl)acetonitrile.
| Compound Name | (2S)-2-amino-2-(2,5-difluorophenyl)acetonitrile |
|---|---|
| PubChem CID | 51887355 |
| Molecular Formula | C8H6F2N2 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.05 |
| IUPAC Name | (2S)-2-amino-2-(2,5-difluorophenyl)acetonitrile |
| SMILES | N#C[C@@H](N)c1cc(F)ccc1F |
| InChI | InChI=1S/C8H6F2N2/c9-5-1-2-7(10)6(3-5)8(12)4-11/h1-3,8H,12H2/t8-/m1/s1 |
| InChIKey | KHFQZWKSHNKHJN-MRVPVSSYSA-N |
| XLogP | 1.49 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |