C11H10F2N2O — CID 116944480
3-[amino-(2,5-difluorophenyl)methyl]oxetane-3-carbonitrile (PubChem CID 116944480) has the molecular formula C11H10F2N2O and a molecular weight of 224.21 g/mol. Its IUPAC name is 3-[amino-(2,5-difluorophenyl)methyl]oxetane-3-carbonitrile.
| Compound Name | 3-[amino-(2,5-difluorophenyl)methyl]oxetane-3-carbonitrile |
|---|---|
| PubChem CID | 116944480 |
| Molecular Formula | C11H10F2N2O |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-[amino-(2,5-difluorophenyl)methyl]oxetane-3-carbonitrile |
| SMILES | N#CC1(C(N)c2cc(F)ccc2F)COC1 |
| InChI | InChI=1S/C11H10F2N2O/c12-7-1-2-9(13)8(3-7)10(15)11(4-14)5-16-6-11/h1-3,10H,5-6,15H2 |
| InChIKey | ZZEBQJBKSGHJOG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |