C15H20BrNO2S — CID 82888976
6-bromo-N-ethyl-10-methyl-2,3,7,9,10,11-hexahydrothiepino[3,4-h][1,4]benzodioxin-11-amine (PubChem CID 82888976) has the molecular formula C15H20BrNO2S and a molecular weight of 358.30 g/mol. Its IUPAC name is 6-bromo-N-ethyl-10-methyl-2,3,7,9,10,11-hexahydrothiepino[3,4-h][1,4]benzodioxin-11-amine.
| Compound Name | 6-bromo-N-ethyl-10-methyl-2,3,7,9,10,11-hexahydrothiepino[3,4-h][1,4]benzodioxin-11-amine |
|---|---|
| PubChem CID | 82888976 |
| Molecular Formula | C15H20BrNO2S |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 6-bromo-N-ethyl-10-methyl-2,3,7,9,10,11-hexahydrothiepino[3,4-h][1,4]benzodioxin-11-amine |
| SMILES | CCNC1c2c(c(Br)cc3c2OCCO3)CSCC1C |
| InChI | InChI=1S/C15H20BrNO2S/c1-3-17-14-9(2)7-20-8-10-11(16)6-12-15(13(10)14)19-5-4-18-12/h6,9,14,17H,3-5,7-8H2,1-2H3 |
| InChIKey | DWFIFYSARDGDDJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |