C13H16BrNO2S — CID 82889830
(11R)-6-bromo-9-methyl-2,3,7,9,10,11-hexahydrothiepino[3,4-h][1,4]benzodioxin-11-amine (PubChem CID 82889830) has the molecular formula C13H16BrNO2S and a molecular weight of 330.25 g/mol. Its IUPAC name is (11R)-6-bromo-9-methyl-2,3,7,9,10,11-hexahydrothiepino[3,4-h][1,4]benzodioxin-11-amine.
| Compound Name | (11R)-6-bromo-9-methyl-2,3,7,9,10,11-hexahydrothiepino[3,4-h][1,4]benzodioxin-11-amine |
|---|---|
| PubChem CID | 82889830 |
| Molecular Formula | C13H16BrNO2S |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | (11R)-6-bromo-9-methyl-2,3,7,9,10,11-hexahydrothiepino[3,4-h][1,4]benzodioxin-11-amine |
| SMILES | CC1C[C@@H](N)c2c(c(Br)cc3c2OCCO3)CS1 |
| InChI | InChI=1S/C13H16BrNO2S/c1-7-4-10(15)12-8(6-18-7)9(14)5-11-13(12)17-3-2-16-11/h5,7,10H,2-4,6,15H2,1H3/t7?,10-/m1/s1 |
| InChIKey | OBSNBXXOSHXHLT-OMNKOJBGSA-N |
| XLogP | 3.25 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |