C14H18ClNOS — CID 113403857
5-chloro-N,7-dimethyl-2,3,6,7,8,10-hexahydrothiepino[4,3-g][1]benzofuran-6-amine (PubChem CID 113403857) has the molecular formula C14H18ClNOS and a molecular weight of 283.82 g/mol. Its IUPAC name is 5-chloro-N,7-dimethyl-2,3,6,7,8,10-hexahydrothiepino[4,3-g][1]benzofuran-6-amine.
| Compound Name | 5-chloro-N,7-dimethyl-2,3,6,7,8,10-hexahydrothiepino[4,3-g][1]benzofuran-6-amine |
|---|---|
| PubChem CID | 113403857 |
| Molecular Formula | C14H18ClNOS |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 5-chloro-N,7-dimethyl-2,3,6,7,8,10-hexahydrothiepino[4,3-g][1]benzofuran-6-amine |
| SMILES | CNC1c2c(Cl)cc3c(c2CSCC1C)OCC3 |
| InChI | InChI=1S/C14H18ClNOS/c1-8-6-18-7-10-12(13(8)16-2)11(15)5-9-3-4-17-14(9)10/h5,8,13,16H,3-4,6-7H2,1-2H3 |
| InChIKey | GLEVUIXBXCFPTF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |