C13H18N4O3S — CID 82899595
4-amino-3-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]benzenesulfonamide (PubChem CID 82899595) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-amino-3-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]benzenesulfonamide.
| Compound Name | 4-amino-3-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 82899595 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-amino-3-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]benzenesulfonamide |
| SMILES | Cc1noc(C)c1C(C)Nc1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C13H18N4O3S/c1-7(13-8(2)17-20-9(13)3)16-12-6-10(21(15,18)19)4-5-11(12)14/h4-7,16H,14H2,1-3H3,(H2,15,18,19) |
| InChIKey | WANYPZUNPVATTP-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|