C13H23N3O3S — CID 82901521
4-amino-N-ethyl-3-(5-hydroxypentan-2-ylamino)benzenesulfonamide (PubChem CID 82901521) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-(5-hydroxypentan-2-ylamino)benzenesulfonamide.
| Compound Name | 4-amino-N-ethyl-3-(5-hydroxypentan-2-ylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 82901521 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-amino-N-ethyl-3-(5-hydroxypentan-2-ylamino)benzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(N)c(NC(C)CCCO)c1 |
| InChI | InChI=1S/C13H23N3O3S/c1-3-15-20(18,19)11-6-7-12(14)13(9-11)16-10(2)5-4-8-17/h6-7,9-10,15-17H,3-5,8,14H2,1-2H3 |
| InChIKey | VODMRQHHCGLCDP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|