C15H19NO2S — CID 82905096
1,2,3,4-tetrahydronaphthalen-1-yl thiomorpholine-3-carboxylate (PubChem CID 82905096) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-yl thiomorpholine-3-carboxylate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-1-yl thiomorpholine-3-carboxylate |
|---|---|
| PubChem CID | 82905096 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-1-yl thiomorpholine-3-carboxylate |
| SMILES | O=C(OC1CCCc2ccccc21)C1CSCCN1 |
| InChI | InChI=1S/C15H19NO2S/c17-15(13-10-19-9-8-16-13)18-14-7-3-5-11-4-1-2-6-12(11)14/h1-2,4,6,13-14,16H,3,5,7-10H2 |
| InChIKey | ADROPOVOJNASLC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |