C11H13ClN2O6S — CID 82912140
2-[4-(methylamino)-4-oxobutoxy]-5-nitrobenzenesulfonyl chloride (PubChem CID 82912140) has the molecular formula C11H13ClN2O6S and a molecular weight of 336.75 g/mol. Its IUPAC name is 2-[4-(methylamino)-4-oxobutoxy]-5-nitrobenzenesulfonyl chloride.
| Compound Name | 2-[4-(methylamino)-4-oxobutoxy]-5-nitrobenzenesulfonyl chloride |
|---|---|
| PubChem CID | 82912140 |
| Molecular Formula | C11H13ClN2O6S |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 2-[4-(methylamino)-4-oxobutoxy]-5-nitrobenzenesulfonyl chloride |
| SMILES | CNC(=O)CCCOc1ccc([N+](=O)[O-])cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H13ClN2O6S/c1-13-11(15)3-2-6-20-9-5-4-8(14(16)17)7-10(9)21(12,18)19/h4-5,7H,2-3,6H2,1H3,(H,13,15) |
| InChIKey | TYVIABGOCATFFI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|