C17H20F2N2 — CID 82915692
4-(aminomethyl)-N-[(3,4-difluorophenyl)methyl]-N-propan-2-ylaniline (PubChem CID 82915692) has the molecular formula C17H20F2N2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(3,4-difluorophenyl)methyl]-N-propan-2-ylaniline.
| Compound Name | 4-(aminomethyl)-N-[(3,4-difluorophenyl)methyl]-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 82915692 |
| Molecular Formula | C17H20F2N2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 4-(aminomethyl)-N-[(3,4-difluorophenyl)methyl]-N-propan-2-ylaniline |
| SMILES | CC(C)N(Cc1ccc(F)c(F)c1)c1ccc(CN)cc1 |
| InChI | InChI=1S/C17H20F2N2/c1-12(2)21(15-6-3-13(10-20)4-7-15)11-14-5-8-16(18)17(19)9-14/h3-9,12H,10-11,20H2,1-2H3 |
| InChIKey | FWKMFFBATLRYLZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|