C10H17N3S2 — CID 82916054
2-(1,3-thiazol-4-yl)-N-(thiomorpholin-3-ylmethyl)ethanamine (PubChem CID 82916054) has the molecular formula C10H17N3S2 and a molecular weight of 243.40 g/mol. Its IUPAC name is 2-(1,3-thiazol-4-yl)-N-(thiomorpholin-3-ylmethyl)ethanamine.
| Compound Name | 2-(1,3-thiazol-4-yl)-N-(thiomorpholin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 82916054 |
| Molecular Formula | C10H17N3S2 |
| Molecular Weight | 243.40 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-(1,3-thiazol-4-yl)-N-(thiomorpholin-3-ylmethyl)ethanamine |
| SMILES | c1nc(CCNCC2CSCCN2)cs1 |
| InChI | InChI=1S/C10H17N3S2/c1(9-6-15-8-13-9)2-11-5-10-7-14-4-3-12-10/h6,8,10-12H,1-5,7H2 |
| InChIKey | APHQHERAYGUXHJ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|