C13H11F3N2 — CID 82923360
2-(3,4-difluorophenyl)-1-(5-fluoro-2-pyridinyl)ethanamine (PubChem CID 82923360) has the molecular formula C13H11F3N2 and a molecular weight of 252.24 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-1-(5-fluoro-2-pyridinyl)ethanamine.
| Compound Name | 2-(3,4-difluorophenyl)-1-(5-fluoro-2-pyridinyl)ethanamine |
|---|---|
| PubChem CID | 82923360 |
| Molecular Formula | C13H11F3N2 |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-(3,4-difluorophenyl)-1-(5-fluoro-2-pyridinyl)ethanamine |
| SMILES | NC(Cc1ccc(F)c(F)c1)c1ccc(F)cn1 |
| InChI | InChI=1S/C13H11F3N2/c14-9-2-4-13(18-7-9)12(17)6-8-1-3-10(15)11(16)5-8/h1-5,7,12H,6,17H2 |
| InChIKey | DETOZCZSXKJLDL-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |