C14H17BrO4S — CID 82932916
2-(2-bromophenyl)sulfonyl-2-cyclohexylacetic acid (PubChem CID 82932916) has the molecular formula C14H17BrO4S and a molecular weight of 361.26 g/mol. Its IUPAC name is 2-(2-bromophenyl)sulfonyl-2-cyclohexylacetic acid.
| Compound Name | 2-(2-bromophenyl)sulfonyl-2-cyclohexylacetic acid |
|---|---|
| PubChem CID | 82932916 |
| Molecular Formula | C14H17BrO4S |
| Molecular Weight | 361.26 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 2-(2-bromophenyl)sulfonyl-2-cyclohexylacetic acid |
| SMILES | O=C(O)C(C1CCCCC1)S(=O)(=O)c1ccccc1Br |
| InChI | InChI=1S/C14H17BrO4S/c15-11-8-4-5-9-12(11)20(18,19)13(14(16)17)10-6-2-1-3-7-10/h4-5,8-10,13H,1-3,6-7H2,(H,16,17) |
| InChIKey | WJRCONPTXFKZOP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |