C15H23ClO2 — CID 82934889
2-(3-chlorophenyl)-2-(2-ethylbutyl)propane-1,3-diol (PubChem CID 82934889) has the molecular formula C15H23ClO2 and a molecular weight of 270.80 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-2-(2-ethylbutyl)propane-1,3-diol.
| Compound Name | 2-(3-chlorophenyl)-2-(2-ethylbutyl)propane-1,3-diol |
|---|---|
| PubChem CID | 82934889 |
| Molecular Formula | C15H23ClO2 |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(3-chlorophenyl)-2-(2-ethylbutyl)propane-1,3-diol |
| SMILES | CCC(CC)CC(CO)(CO)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClO2/c1-3-12(4-2)9-15(10-17,11-18)13-6-5-7-14(16)8-13/h5-8,12,17-18H,3-4,9-11H2,1-2H3 |
| InChIKey | FYFZJCCHVPYIJR-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |