C17H17BrF2 — CID 82935081
4-[2-(bromomethyl)-3-(2-methylphenyl)propyl]-1,2-difluorobenzene (PubChem CID 82935081) has the molecular formula C17H17BrF2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-3-(2-methylphenyl)propyl]-1,2-difluorobenzene.
| Compound Name | 4-[2-(bromomethyl)-3-(2-methylphenyl)propyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 82935081 |
| Molecular Formula | C17H17BrF2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-[2-(bromomethyl)-3-(2-methylphenyl)propyl]-1,2-difluorobenzene |
| SMILES | Cc1ccccc1CC(CBr)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H17BrF2/c1-12-4-2-3-5-15(12)9-14(11-18)8-13-6-7-16(19)17(20)10-13/h2-7,10,14H,8-9,11H2,1H3 |
| InChIKey | JFBMMVQOOCXUCX-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|