C18H34N2 — CID 82937126
1-cyclopentyl-3,3-diethyl-1,4-diazaspiro[5.5]undecane (PubChem CID 82937126) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 1-cyclopentyl-3,3-diethyl-1,4-diazaspiro[5.5]undecane.
| Compound Name | 1-cyclopentyl-3,3-diethyl-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 82937126 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 1-cyclopentyl-3,3-diethyl-1,4-diazaspiro[5.5]undecane |
| SMILES | CCC1(CC)CN(C2CCCC2)C2(CCCCC2)CN1 |
| InChI | InChI=1S/C18H34N2/c1-3-17(4-2)15-20(16-10-6-7-11-16)18(14-19-17)12-8-5-9-13-18/h16,19H,3-15H2,1-2H3 |
| InChIKey | WYBOHGCQVJGFHD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |