About 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane
6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane (PubChem CID 64861043) has the molecular formula C18H36N2O
and a molecular weight of 296.50 g/mol. Its IUPAC name is 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane |
| PubChem CID | 64861043 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCCCOCCN1CC(CC)(CC)NCC12CCCC2 |
| InChI | InChI=1S/C18H36N2O/c1-4-7-13-21-14-12-20-16-17(5-2,6-3)19-15-18(20)10-8-9-11-18/h19H,4-16H2,1-3H3 |
| InChIKey | WAQRYPTUGOZPQN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane?
The IUPAC name of 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane (CID 64861043) is 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane.
What is the SMILES notation for 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane?
The canonical SMILES for 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane is CCCCOCCN1CC(CC)(CC)NCC12CCCC2.
What is the InChIKey of 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane?
The InChIKey is WAQRYPTUGOZPQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2O/c1-4-7-13-21-14-12-20-16-17(5-2,6-3)19-15-18(20)10-8-9-11-18/h19H,4-16H2,1-3H3.
What are the key properties of 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane?
6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane has a molecular weight of 296.50 g/mol, XLogP of 3.58, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-butoxyethyl)-8,8-diethyl-6,9-diazaspiro[4.5]decane is sourced from PubChem (CID 64861043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).