C16H32N2 — CID 79446556
6-butan-2-yl-8,8-diethyl-6,9-diazaspiro[4.5]decane (PubChem CID 79446556) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 6-butan-2-yl-8,8-diethyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 6-butan-2-yl-8,8-diethyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 79446556 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 6-butan-2-yl-8,8-diethyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCC(C)N1CC(CC)(CC)NCC12CCCC2 |
| InChI | InChI=1S/C16H32N2/c1-5-14(4)18-13-15(6-2,7-3)17-12-16(18)10-8-9-11-16/h14,17H,5-13H2,1-4H3 |
| InChIKey | SNEOYCCROPJTDO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |