C16H22BrN3O — CID 82955267
6-[2-(1-aminoethyl)-4-bromophenyl]-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one (PubChem CID 82955267) has the molecular formula C16H22BrN3O and a molecular weight of 352.28 g/mol. Its IUPAC name is 6-[2-(1-aminoethyl)-4-bromophenyl]-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one.
| Compound Name | 6-[2-(1-aminoethyl)-4-bromophenyl]-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 82955267 |
| Molecular Formula | C16H22BrN3O |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 6-[2-(1-aminoethyl)-4-bromophenyl]-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-2-one |
| SMILES | CC(N)c1cc(Br)ccc1N1CCC2NC(=O)CCC2C1 |
| InChI | InChI=1S/C16H22BrN3O/c1-10(18)13-8-12(17)3-4-15(13)20-7-6-14-11(9-20)2-5-16(21)19-14/h3-4,8,10-11,14H,2,5-7,9,18H2,1H3,(H,19,21) |
| InChIKey | NCTKAGAVBHTSPA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |