C10H11ClF3NO — CID 82955311
3-(chloromethyl)-2-methyl-6-(3,3,3-trifluoropropoxy)pyridine (PubChem CID 82955311) has the molecular formula C10H11ClF3NO and a molecular weight of 253.65 g/mol. Its IUPAC name is 3-(chloromethyl)-2-methyl-6-(3,3,3-trifluoropropoxy)pyridine.
| Compound Name | 3-(chloromethyl)-2-methyl-6-(3,3,3-trifluoropropoxy)pyridine |
|---|---|
| PubChem CID | 82955311 |
| Molecular Formula | C10H11ClF3NO |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 3-(chloromethyl)-2-methyl-6-(3,3,3-trifluoropropoxy)pyridine |
| SMILES | Cc1nc(OCCC(F)(F)F)ccc1CCl |
| InChI | InChI=1S/C10H11ClF3NO/c1-7-8(6-11)2-3-9(15-7)16-5-4-10(12,13)14/h2-3H,4-6H2,1H3 |
| InChIKey | HZDAGZICHBUYQY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|