C18H26N2O — CID 82965163
1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2,3-dihydro-1H-inden-4-ol (PubChem CID 82965163) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is 1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 82965163 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2,3-dihydro-1H-inden-4-ol |
| SMILES | CC1CN2CCCCC2CN1C1CCc2c(O)cccc21 |
| InChI | InChI=1S/C18H26N2O/c1-13-11-19-10-3-2-5-14(19)12-20(13)17-9-8-16-15(17)6-4-7-18(16)21/h4,6-7,13-14,17,21H,2-3,5,8-12H2,1H3 |
| InChIKey | XSAHHVGOSOFUFX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |