C13H15BrFNO2 — CID 82967568
methyl 2-(5-bromo-2-fluorophenyl)-2-(prop-2-enylamino)propanoate (PubChem CID 82967568) has the molecular formula C13H15BrFNO2 and a molecular weight of 316.17 g/mol. Its IUPAC name is methyl 2-(5-bromo-2-fluorophenyl)-2-(prop-2-enylamino)propanoate.
| Compound Name | methyl 2-(5-bromo-2-fluorophenyl)-2-(prop-2-enylamino)propanoate |
|---|---|
| PubChem CID | 82967568 |
| Molecular Formula | C13H15BrFNO2 |
| Molecular Weight | 316.17 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | methyl 2-(5-bromo-2-fluorophenyl)-2-(prop-2-enylamino)propanoate |
| SMILES | C=CCNC(C)(C(=O)OC)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H15BrFNO2/c1-4-7-16-13(2,12(17)18-3)10-8-9(14)5-6-11(10)15/h4-6,8,16H,1,7H2,2-3H3 |
| InChIKey | WTKMIRSMJHQGQD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.17 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|