About 4-propylbenzenediazonium tetrafluoroborate
4-propylbenzenediazonium tetrafluoroborate (PubChem CID 82974034) has the molecular formula C9H11BF4N2
and a molecular weight of 234.01 g/mol. Its IUPAC name is 4-propylbenzenediazonium tetrafluoroborate.
Molecular Properties
| Compound Name | 4-propylbenzenediazonium tetrafluoroborate |
| PubChem CID | 82974034 |
| Molecular Formula | C9H11BF4N2 |
| Molecular Weight | 234.01 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 4-propylbenzenediazonium tetrafluoroborate |
| SMILES | CCCc1ccc([N+]#N)cc1.F[B-](F)(F)F |
| InChI | InChI=1S/C9H11N2.BF4/c1-2-3-8-4-6-9(11-10)7-5-8;2-1(3,4)5/h4-7H,2-3H2,1H3;/q+1;-1 |
| InChIKey | QQYIYGUBTLXPEB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 28.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.01 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-propylbenzenediazonium tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylbenzenediazonium tetrafluoroborate?
The IUPAC name of 4-propylbenzenediazonium tetrafluoroborate (CID 82974034) is 4-propylbenzenediazonium tetrafluoroborate.
What is the SMILES notation for 4-propylbenzenediazonium tetrafluoroborate?
The canonical SMILES for 4-propylbenzenediazonium tetrafluoroborate is CCCc1ccc([N+]#N)cc1.F[B-](F)(F)F.
What is the InChIKey of 4-propylbenzenediazonium tetrafluoroborate?
The InChIKey is QQYIYGUBTLXPEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N2.BF4/c1-2-3-8-4-6-9(11-10)7-5-8;2-1(3,4)5/h4-7H,2-3H2,1H3;/q+1;-1.
What are the key properties of 4-propylbenzenediazonium tetrafluoroborate?
4-propylbenzenediazonium tetrafluoroborate has a molecular weight of 234.01 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylbenzenediazonium tetrafluoroborate is sourced from PubChem (CID 82974034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).