C12H15ClF3NO — CID 82981574
3-chloro-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]phenol (PubChem CID 82981574) has the molecular formula C12H15ClF3NO and a molecular weight of 281.70 g/mol. Its IUPAC name is 3-chloro-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]phenol.
| Compound Name | 3-chloro-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 82981574 |
| Molecular Formula | C12H15ClF3NO |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-chloro-2-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]phenol |
| SMILES | CC(C)N(Cc1c(O)cccc1Cl)CC(F)(F)F |
| InChI | InChI=1S/C12H15ClF3NO/c1-8(2)17(7-12(14,15)16)6-9-10(13)4-3-5-11(9)18/h3-5,8,18H,6-7H2,1-2H3 |
| InChIKey | BSIKFTMCIVFDSK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|