C12H14BrClF3N — CID 107082257
2-(bromomethyl)-3-chloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 107082257) has the molecular formula C12H14BrClF3N and a molecular weight of 344.60 g/mol. Its IUPAC name is 2-(bromomethyl)-3-chloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 2-(bromomethyl)-3-chloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 107082257 |
| Molecular Formula | C12H14BrClF3N |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 2-(bromomethyl)-3-chloro-N-propan-2-yl-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CC(C)N(CC(F)(F)F)c1cccc(Cl)c1CBr |
| InChI | InChI=1S/C12H14BrClF3N/c1-8(2)18(7-12(15,16)17)11-5-3-4-10(14)9(11)6-13/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | KMVKPKIFYVQCTD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|