C14H16F3N3 — CID 82994397
5-(3,3-dimethylpiperazin-1-yl)-2-(trifluoromethyl)benzonitrile (PubChem CID 82994397) has the molecular formula C14H16F3N3 and a molecular weight of 283.30 g/mol. Its IUPAC name is 5-(3,3-dimethylpiperazin-1-yl)-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-(3,3-dimethylpiperazin-1-yl)-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 82994397 |
| Molecular Formula | C14H16F3N3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 5-(3,3-dimethylpiperazin-1-yl)-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)CN(c2ccc(C(F)(F)F)c(C#N)c2)CCN1 |
| InChI | InChI=1S/C14H16F3N3/c1-13(2)9-20(6-5-19-13)11-3-4-12(14(15,16)17)10(7-11)8-18/h3-4,7,19H,5-6,9H2,1-2H3 |
| InChIKey | JMSCYFQVSOSLOX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |