C11H26N4O2 — CID 83011458
3,3-dimethoxy-2-methyl-2-N-(4-methylpiperazin-1-yl)propane-1,2-diamine (PubChem CID 83011458) has the molecular formula C11H26N4O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 3,3-dimethoxy-2-methyl-2-N-(4-methylpiperazin-1-yl)propane-1,2-diamine.
| Compound Name | 3,3-dimethoxy-2-methyl-2-N-(4-methylpiperazin-1-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 83011458 |
| Molecular Formula | C11H26N4O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | 3,3-dimethoxy-2-methyl-2-N-(4-methylpiperazin-1-yl)propane-1,2-diamine |
| SMILES | COC(OC)C(C)(CN)NN1CCN(C)CC1 |
| InChI | InChI=1S/C11H26N4O2/c1-11(9-12,10(16-3)17-4)13-15-7-5-14(2)6-8-15/h10,13H,5-9,12H2,1-4H3 |
| InChIKey | XOAKNPTZTPEYFZ-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 62.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|