C15H25N3 — CID 83011948
1-(2,3-dimethylphenyl)-N-piperidin-1-ylethane-1,2-diamine (PubChem CID 83011948) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-N-piperidin-1-ylethane-1,2-diamine.
| Compound Name | 1-(2,3-dimethylphenyl)-N-piperidin-1-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 83011948 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-N-piperidin-1-ylethane-1,2-diamine |
| SMILES | Cc1cccc(C(CN)NN2CCCCC2)c1C |
| InChI | InChI=1S/C15H25N3/c1-12-7-6-8-14(13(12)2)15(11-16)17-18-9-4-3-5-10-18/h6-8,15,17H,3-5,9-11,16H2,1-2H3 |
| InChIKey | AMQUTNIPCASGPY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |