C11H17ClN4O2S — CID 83013225
4-amino-2-chloro-N-(4-methylpiperazin-1-yl)benzenesulfonamide (PubChem CID 83013225) has the molecular formula C11H17ClN4O2S and a molecular weight of 304.80 g/mol. Its IUPAC name is 4-amino-2-chloro-N-(4-methylpiperazin-1-yl)benzenesulfonamide.
| Compound Name | 4-amino-2-chloro-N-(4-methylpiperazin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 83013225 |
| Molecular Formula | C11H17ClN4O2S |
| Molecular Weight | 304.80 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 4-amino-2-chloro-N-(4-methylpiperazin-1-yl)benzenesulfonamide |
| SMILES | CN1CCN(NS(=O)(=O)c2ccc(N)cc2Cl)CC1 |
| InChI | InChI=1S/C11H17ClN4O2S/c1-15-4-6-16(7-5-15)14-19(17,18)11-3-2-9(13)8-10(11)12/h2-3,8,14H,4-7,13H2,1H3 |
| InChIKey | BQEGYDWEMKZLDY-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.80 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|