C14H23N3O — CID 83013680
2-N-morpholin-4-yl-4-phenylbutane-1,2-diamine (PubChem CID 83013680) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-N-morpholin-4-yl-4-phenylbutane-1,2-diamine.
| Compound Name | 2-N-morpholin-4-yl-4-phenylbutane-1,2-diamine |
|---|---|
| PubChem CID | 83013680 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-N-morpholin-4-yl-4-phenylbutane-1,2-diamine |
| SMILES | NCC(CCc1ccccc1)NN1CCOCC1 |
| InChI | InChI=1S/C14H23N3O/c15-12-14(16-17-8-10-18-11-9-17)7-6-13-4-2-1-3-5-13/h1-5,14,16H,6-12,15H2 |
| InChIKey | ZMQKEEWZRUPMMX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |