C20H28N2O — CID 23467801
1-amino-3-(1,5-diphenylpentan-3-ylamino)propan-2-ol (PubChem CID 23467801) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is 1-amino-3-(1,5-diphenylpentan-3-ylamino)propan-2-ol.
| Compound Name | 1-amino-3-(1,5-diphenylpentan-3-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 23467801 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | 1-amino-3-(1,5-diphenylpentan-3-ylamino)propan-2-ol |
| SMILES | NCC(O)CNC(CCc1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C20H28N2O/c21-15-20(23)16-22-19(13-11-17-7-3-1-4-8-17)14-12-18-9-5-2-6-10-18/h1-10,19-20,22-23H,11-16,21H2 |
| InChIKey | NKCRYQDWMGHHTL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |