About butyl 2-(2,2-dimethylhydrazinyl)acetate
butyl 2-(2,2-dimethylhydrazinyl)acetate (PubChem CID 83014680) has the molecular formula C8H18N2O2
and a molecular weight of 174.24 g/mol. Its IUPAC name is butyl 2-(2,2-dimethylhydrazinyl)acetate.
Molecular Properties
| Compound Name | butyl 2-(2,2-dimethylhydrazinyl)acetate |
| PubChem CID | 83014680 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | butyl 2-(2,2-dimethylhydrazinyl)acetate |
| SMILES | CCCCOC(=O)CNN(C)C |
| InChI | InChI=1S/C8H18N2O2/c1-4-5-6-12-8(11)7-9-10(2)3/h9H,4-7H2,1-3H3 |
| InChIKey | BQAWAKBGOHXAKD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-(2,2-dimethylhydrazinyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-(2,2-dimethylhydrazinyl)acetate?
The IUPAC name of butyl 2-(2,2-dimethylhydrazinyl)acetate (CID 83014680) is butyl 2-(2,2-dimethylhydrazinyl)acetate.
What is the SMILES notation for butyl 2-(2,2-dimethylhydrazinyl)acetate?
The canonical SMILES for butyl 2-(2,2-dimethylhydrazinyl)acetate is CCCCOC(=O)CNN(C)C.
What is the InChIKey of butyl 2-(2,2-dimethylhydrazinyl)acetate?
The InChIKey is BQAWAKBGOHXAKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O2/c1-4-5-6-12-8(11)7-9-10(2)3/h9H,4-7H2,1-3H3.
What are the key properties of butyl 2-(2,2-dimethylhydrazinyl)acetate?
butyl 2-(2,2-dimethylhydrazinyl)acetate has a molecular weight of 174.24 g/mol, XLogP of 0.40, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-(2,2-dimethylhydrazinyl)acetate is sourced from PubChem (CID 83014680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).