C8H11BrN2O2S — CID 83023481
4-bromo-N',N'-dimethylbenzenesulfonohydrazide (PubChem CID 83023481) has the molecular formula C8H11BrN2O2S and a molecular weight of 279.16 g/mol. Its IUPAC name is 4-bromo-N',N'-dimethylbenzenesulfonohydrazide.
| Compound Name | 4-bromo-N',N'-dimethylbenzenesulfonohydrazide |
|---|---|
| PubChem CID | 83023481 |
| Molecular Formula | C8H11BrN2O2S |
| Molecular Weight | 279.16 g/mol |
| Exact Mass | 277.97 |
| IUPAC Name | 4-bromo-N',N'-dimethylbenzenesulfonohydrazide |
| SMILES | CN(C)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C8H11BrN2O2S/c1-11(2)10-14(12,13)8-5-3-7(9)4-6-8/h3-6,10H,1-2H3 |
| InChIKey | BNYOCBOYSKUXHW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|