C8H13N5O2 — CID 83023643
5-methyl-N-morpholin-4-yl-1H-1,2,4-triazole-3-carboxamide (PubChem CID 83023643) has the molecular formula C8H13N5O2 and a molecular weight of 211.22 g/mol. Its IUPAC name is 5-methyl-N-morpholin-4-yl-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-methyl-N-morpholin-4-yl-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 83023643 |
| Molecular Formula | C8H13N5O2 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 5-methyl-N-morpholin-4-yl-1H-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1nc(C(=O)NN2CCOCC2)n[nH]1 |
| InChI | InChI=1S/C8H13N5O2/c1-6-9-7(11-10-6)8(14)12-13-2-4-15-5-3-13/h2-5H2,1H3,(H,12,14)(H,9,10,11) |
| InChIKey | DDQREISDPFOULJ-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |