C6H10N4 — CID 83025719
1,1-dimethyl-2-pyrazin-2-ylhydrazine (PubChem CID 83025719) has the molecular formula C6H10N4 and a molecular weight of 138.17 g/mol. Its IUPAC name is 1,1-dimethyl-2-pyrazin-2-ylhydrazine.
| Compound Name | 1,1-dimethyl-2-pyrazin-2-ylhydrazine |
|---|---|
| PubChem CID | 83025719 |
| Molecular Formula | C6H10N4 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | 1,1-dimethyl-2-pyrazin-2-ylhydrazine |
| SMILES | CN(C)Nc1cnccn1 |
| InChI | InChI=1S/C6H10N4/c1-10(2)9-6-5-7-3-4-8-6/h3-5H,1-2H3,(H,8,9) |
| InChIKey | HEUNFYAZMUOOAB-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|