C9H19N5O2 — CID 83035306
methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-methylpentanoate (PubChem CID 83035306) has the molecular formula C9H19N5O2 and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 83035306 |
| Molecular Formula | C9H19N5O2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | methyl 2-[[amino-(diaminomethylideneamino)methylidene]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)/N=C(\N)N=C(N)N |
| InChI | InChI=1S/C9H19N5O2/c1-5(2)4-6(7(15)16-3)13-9(12)14-8(10)11/h5-6H,4H2,1-3H3,(H6,10,11,12,13,14) |
| InChIKey | YOFDQVOMZDRWOL-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|