About 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide
4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide (PubChem CID 83037271) has the molecular formula C16H25N3O2
and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide |
| PubChem CID | 83037271 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide |
| SMILES | CCC1(CC)CC(Nc2ccnc(C(=O)NC)c2)CCO1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-16(5-2)11-13(7-9-21-16)19-12-6-8-18-14(10-12)15(20)17-3/h6,8,10,13H,4-5,7,9,11H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | XZGYPSPZGCBOQE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide?
The IUPAC name of 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide (CID 83037271) is 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide.
What is the SMILES notation for 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide?
The canonical SMILES for 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide is CCC1(CC)CC(Nc2ccnc(C(=O)NC)c2)CCO1.
What is the InChIKey of 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide?
The InChIKey is XZGYPSPZGCBOQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2/c1-4-16(5-2)11-13(7-9-21-16)19-12-6-8-18-14(10-12)15(20)17-3/h6,8,10,13H,4-5,7,9,11H2,1-3H3,(H,17,20)(H,18,19).
What are the key properties of 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide?
4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide has a molecular weight of 291.39 g/mol, XLogP of 2.59, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,2-diethyloxan-4-yl)amino]-N-methylpyridine-2-carboxamide is sourced from PubChem (CID 83037271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).