C15H22O5 — CID 83042755
2-[1-(2,4-dimethoxyphenyl)-1-hydroxyethyl]pentanoic acid (PubChem CID 83042755) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[1-(2,4-dimethoxyphenyl)-1-hydroxyethyl]pentanoic acid.
| Compound Name | 2-[1-(2,4-dimethoxyphenyl)-1-hydroxyethyl]pentanoic acid |
|---|---|
| PubChem CID | 83042755 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-[1-(2,4-dimethoxyphenyl)-1-hydroxyethyl]pentanoic acid |
| SMILES | CCCC(C(=O)O)C(C)(O)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H22O5/c1-5-6-12(14(16)17)15(2,18)11-8-7-10(19-3)9-13(11)20-4/h7-9,12,18H,5-6H2,1-4H3,(H,16,17) |
| InChIKey | WQTHRROJPDBAQB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |