C16H30O3 — CID 83051168
ethyl 2-hydroxy-2-(3,3,5-trimethylcyclohexyl)pentanoate (PubChem CID 83051168) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(3,3,5-trimethylcyclohexyl)pentanoate.
| Compound Name | ethyl 2-hydroxy-2-(3,3,5-trimethylcyclohexyl)pentanoate |
|---|---|
| PubChem CID | 83051168 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | ethyl 2-hydroxy-2-(3,3,5-trimethylcyclohexyl)pentanoate |
| SMILES | CCCC(O)(C(=O)OCC)C1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C16H30O3/c1-6-8-16(18,14(17)19-7-2)13-9-12(3)10-15(4,5)11-13/h12-13,18H,6-11H2,1-5H3 |
| InChIKey | LCVJKQICUAXWKM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |