C17H32O3 — CID 83051486
ethyl 2-hydroxy-2-(5-methyl-2-propan-2-ylcyclohexyl)pentanoate (PubChem CID 83051486) has the molecular formula C17H32O3 and a molecular weight of 284.44 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(5-methyl-2-propan-2-ylcyclohexyl)pentanoate.
| Compound Name | ethyl 2-hydroxy-2-(5-methyl-2-propan-2-ylcyclohexyl)pentanoate |
|---|---|
| PubChem CID | 83051486 |
| Molecular Formula | C17H32O3 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | ethyl 2-hydroxy-2-(5-methyl-2-propan-2-ylcyclohexyl)pentanoate |
| SMILES | CCCC(O)(C(=O)OCC)C1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C17H32O3/c1-6-10-17(19,16(18)20-7-2)15-11-13(5)8-9-14(15)12(3)4/h12-15,19H,6-11H2,1-5H3 |
| InChIKey | LQOWKVKSSZBVGQ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |