C13H13BrO2 — CID 83057556
2-bromo-5-[(2,6-dimethylphenoxy)methyl]furan (PubChem CID 83057556) has the molecular formula C13H13BrO2 and a molecular weight of 281.15 g/mol. Its IUPAC name is 2-bromo-5-[(2,6-dimethylphenoxy)methyl]furan.
| Compound Name | 2-bromo-5-[(2,6-dimethylphenoxy)methyl]furan |
|---|---|
| PubChem CID | 83057556 |
| Molecular Formula | C13H13BrO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 2-bromo-5-[(2,6-dimethylphenoxy)methyl]furan |
| SMILES | Cc1cccc(C)c1OCc1ccc(Br)o1 |
| InChI | InChI=1S/C13H13BrO2/c1-9-4-3-5-10(2)13(9)15-8-11-6-7-12(14)16-11/h3-7H,8H2,1-2H3 |
| InChIKey | GQIXLIBSKFPHKG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |