C7H13ClF3NO2S — CID 83059118
N-(1-chloropropan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83059118) has the molecular formula C7H13ClF3NO2S and a molecular weight of 267.70 g/mol. Its IUPAC name is N-(1-chloropropan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(1-chloropropan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83059118 |
| Molecular Formula | C7H13ClF3NO2S |
| Molecular Weight | 267.70 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | N-(1-chloropropan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CC(CCl)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C7H13ClF3NO2S/c1-6(5-8)12-15(13,14)4-2-3-7(9,10)11/h6,12H,2-5H2,1H3 |
| InChIKey | AMATWBXWOZRSMP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.70 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|