C6H12F3NO2S — CID 87160176
N-(1,1,1-trifluorobutan-2-yl)ethanesulfonamide (PubChem CID 87160176) has the molecular formula C6H12F3NO2S and a molecular weight of 219.23 g/mol. Its IUPAC name is N-(1,1,1-trifluorobutan-2-yl)ethanesulfonamide.
| Compound Name | N-(1,1,1-trifluorobutan-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 87160176 |
| Molecular Formula | C6H12F3NO2S |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | N-(1,1,1-trifluorobutan-2-yl)ethanesulfonamide |
| SMILES | CCC(NS(=O)(=O)CC)C(F)(F)F |
| InChI | InChI=1S/C6H12F3NO2S/c1-3-5(6(7,8)9)10-13(11,12)4-2/h5,10H,3-4H2,1-2H3 |
| InChIKey | RNIABZSSSWBJSR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |