C10H19F3N2O2S — CID 83059127
3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-amine (PubChem CID 83059127) has the molecular formula C10H19F3N2O2S and a molecular weight of 288.33 g/mol. Its IUPAC name is 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-amine.
| Compound Name | 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-amine |
|---|---|
| PubChem CID | 83059127 |
| Molecular Formula | C10H19F3N2O2S |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 3-propyl-1-(4,4,4-trifluorobutylsulfonyl)azetidin-3-amine |
| SMILES | CCCC1(N)CN(S(=O)(=O)CCCC(F)(F)F)C1 |
| InChI | InChI=1S/C10H19F3N2O2S/c1-2-4-9(14)7-15(8-9)18(16,17)6-3-5-10(11,12)13/h2-8,14H2,1H3 |
| InChIKey | RLMSDJMCDSJNNN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |