C9H15F3N2O2S — CID 83059254
N-(1-cyanobutan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 83059254) has the molecular formula C9H15F3N2O2S and a molecular weight of 272.29 g/mol. Its IUPAC name is N-(1-cyanobutan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide.
| Compound Name | N-(1-cyanobutan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 83059254 |
| Molecular Formula | C9H15F3N2O2S |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | N-(1-cyanobutan-2-yl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | CCC(CC#N)NS(=O)(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O2S/c1-2-8(4-6-13)14-17(15,16)7-3-5-9(10,11)12/h8,14H,2-5,7H2,1H3 |
| InChIKey | YYMXJXKLPATMCA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |