C11H18ClN3 — CID 83063008
N-(1-chloro-4-methylpentan-2-yl)-3-methylpyrazin-2-amine (PubChem CID 83063008) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-2-yl)-3-methylpyrazin-2-amine.
| Compound Name | N-(1-chloro-4-methylpentan-2-yl)-3-methylpyrazin-2-amine |
|---|---|
| PubChem CID | 83063008 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-(1-chloro-4-methylpentan-2-yl)-3-methylpyrazin-2-amine |
| SMILES | Cc1nccnc1NC(CCl)CC(C)C |
| InChI | InChI=1S/C11H18ClN3/c1-8(2)6-10(7-12)15-11-9(3)13-4-5-14-11/h4-5,8,10H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | RCBAICPZDIHVRX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|