About N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine
N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine (PubChem CID 83065922) has the molecular formula C17H17BrClN
and a molecular weight of 350.69 g/mol. Its IUPAC name is N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine |
| PubChem CID | 83065922 |
| Molecular Formula | C17H17BrClN |
| Molecular Weight | 350.69 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine |
| SMILES | CC1(C)Cc2ccc(Cl)cc2C1Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrClN/c1-17(2)10-11-3-6-13(19)9-15(11)16(17)20-14-7-4-12(18)5-8-14/h3-9,16,20H,10H2,1-2H3 |
| InChIKey | YGNGJEQQJFDLNX-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine?
The IUPAC name of N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine (CID 83065922) is N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine.
What is the SMILES notation for N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine?
The canonical SMILES for N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine is CC1(C)Cc2ccc(Cl)cc2C1Nc1ccc(Br)cc1.
What is the InChIKey of N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine?
The InChIKey is YGNGJEQQJFDLNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17BrClN/c1-17(2)10-11-3-6-13(19)9-15(11)16(17)20-14-7-4-12(18)5-8-14/h3-9,16,20H,10H2,1-2H3.
What are the key properties of N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine?
N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine has a molecular weight of 350.69 g/mol, XLogP of 5.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromophenyl)-6-chloro-2,2-dimethyl-1,3-dihydroinden-1-amine is sourced from PubChem (CID 83065922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).