C12H10Cl2FN3O2S — CID 83078013
2-amino-4-(2,6-dichloro-4-fluoroanilino)benzenesulfonamide (PubChem CID 83078013) has the molecular formula C12H10Cl2FN3O2S and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-amino-4-(2,6-dichloro-4-fluoroanilino)benzenesulfonamide.
| Compound Name | 2-amino-4-(2,6-dichloro-4-fluoroanilino)benzenesulfonamide |
|---|---|
| PubChem CID | 83078013 |
| Molecular Formula | C12H10Cl2FN3O2S |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 2-amino-4-(2,6-dichloro-4-fluoroanilino)benzenesulfonamide |
| SMILES | Nc1cc(Nc2c(Cl)cc(F)cc2Cl)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C12H10Cl2FN3O2S/c13-8-3-6(15)4-9(14)12(8)18-7-1-2-11(10(16)5-7)21(17,19)20/h1-5,18H,16H2,(H2,17,19,20) |
| InChIKey | WXJWSWTTZHRRNB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|